C24H30N4O3S — CID 50815505
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3,3-dimethylbutanamide (PubChem CID 50815505) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3,3-dimethylbutanamide.
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 50815505 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(CC(=O)NCCN1CCc2ccccc2C1)CC1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C24H30N4O3S/c1-24(2,15-22-26-20-9-5-6-10-21(20)32(30,31)27-22)16-23(29)25-12-14-28-13-11-18-7-3-4-8-19(18)17-28/h3-10H,11-17H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | IQEBTELZTRRPER-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |