About 4-oxo-1,3-thiazolidine-2-carboxylic acid
4-oxo-1,3-thiazolidine-2-carboxylic acid (PubChem CID 5081553) has the molecular formula C4H5NO3S
and a molecular weight of 147.15 g/mol. Its IUPAC name is 4-oxo-1,3-thiazolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-oxo-1,3-thiazolidine-2-carboxylic acid |
| PubChem CID | 5081553 |
| Molecular Formula | C4H5NO3S |
| Molecular Weight | 147.15 g/mol |
| Exact Mass | 147.00 |
| IUPAC Name | 4-oxo-1,3-thiazolidine-2-carboxylic acid |
| SMILES | O=C1CSC(C(=O)O)N1 |
| InChI | InChI=1S/C4H5NO3S/c6-2-1-9-3(5-2)4(7)8/h3H,1H2,(H,5,6)(H,7,8) |
| InChIKey | VCBWTURINQLAAL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.15 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxo-1,3-thiazolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-1,3-thiazolidine-2-carboxylic acid?
The IUPAC name of 4-oxo-1,3-thiazolidine-2-carboxylic acid (CID 5081553) is 4-oxo-1,3-thiazolidine-2-carboxylic acid.
What is the SMILES notation for 4-oxo-1,3-thiazolidine-2-carboxylic acid?
The canonical SMILES for 4-oxo-1,3-thiazolidine-2-carboxylic acid is O=C1CSC(C(=O)O)N1.
What is the InChIKey of 4-oxo-1,3-thiazolidine-2-carboxylic acid?
The InChIKey is VCBWTURINQLAAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3S/c6-2-1-9-3(5-2)4(7)8/h3H,1H2,(H,5,6)(H,7,8).
What are the key properties of 4-oxo-1,3-thiazolidine-2-carboxylic acid?
4-oxo-1,3-thiazolidine-2-carboxylic acid has a molecular weight of 147.15 g/mol, XLogP of -0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-1,3-thiazolidine-2-carboxylic acid is sourced from PubChem (CID 5081553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).