C26H32N4O3 — CID 50815798
N-[2-(4-benzylpiperidin-1-yl)ethyl]-3-(4-methyl-2,3-dioxoquinoxalin-1-yl)propanamide (PubChem CID 50815798) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[2-(4-benzylpiperidin-1-yl)ethyl]-3-(4-methyl-2,3-dioxoquinoxalin-1-yl)propanamide.
| Compound Name | N-[2-(4-benzylpiperidin-1-yl)ethyl]-3-(4-methyl-2,3-dioxoquinoxalin-1-yl)propanamide |
|---|---|
| PubChem CID | 50815798 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-[2-(4-benzylpiperidin-1-yl)ethyl]-3-(4-methyl-2,3-dioxoquinoxalin-1-yl)propanamide |
| SMILES | Cn1c(=O)c(=O)n(CCC(=O)NCCN2CCC(Cc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H32N4O3/c1-28-22-9-5-6-10-23(22)30(26(33)25(28)32)17-13-24(31)27-14-18-29-15-11-21(12-16-29)19-20-7-3-2-4-8-20/h2-10,21H,11-19H2,1H3,(H,27,31) |
| InChIKey | OEACWULVWCWEEM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|