C25H28N4O4 — CID 50815808
4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide (PubChem CID 50815808) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide.
| Compound Name | 4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 50815808 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide |
| SMILES | CCn1c(=O)c(=O)n(Cc2ccc(C(=O)NCCCN3CCCC3=O)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H28N4O4/c1-2-28-20-7-3-4-8-21(20)29(25(33)24(28)32)17-18-10-12-19(13-11-18)23(31)26-14-6-16-27-15-5-9-22(27)30/h3-4,7-8,10-13H,2,5-6,9,14-17H2,1H3,(H,26,31) |
| InChIKey | RROGKZBTJXUHRX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|