C27H35N3O4S — CID 50815951
1-[3-[(4-cyclohexylphenyl)sulfonylamino]benzoyl]-N-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 50815951) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is 1-[3-[(4-cyclohexylphenyl)sulfonylamino]benzoyl]-N-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[(4-cyclohexylphenyl)sulfonylamino]benzoyl]-N-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 50815951 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 1-[3-[(4-cyclohexylphenyl)sulfonylamino]benzoyl]-N-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | CC(C)NC(=O)C1CCCN1C(=O)c1cccc(NS(=O)(=O)c2ccc(C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C27H35N3O4S/c1-19(2)28-26(31)25-12-7-17-30(25)27(32)22-10-6-11-23(18-22)29-35(33,34)24-15-13-21(14-16-24)20-8-4-3-5-9-20/h6,10-11,13-16,18-20,25,29H,3-5,7-9,12,17H2,1-2H3,(H,28,31) |
| InChIKey | CYAYKRVQRQSNFV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |