C24H26N4O3S2 — CID 50816745
N-phenyl-5-[1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidin-3-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 50816745) has the molecular formula C24H26N4O3S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-phenyl-5-[1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidin-3-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-phenyl-5-[1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidin-3-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 50816745 |
| Molecular Formula | C24H26N4O3S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-phenyl-5-[1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidin-3-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1nnc(C2CCCN(S(=O)(=O)c3ccc4c(c3)CCCC4)C2)s1 |
| InChI | InChI=1S/C24H26N4O3S2/c29-22(25-20-10-2-1-3-11-20)24-27-26-23(32-24)19-9-6-14-28(16-19)33(30,31)21-13-12-17-7-4-5-8-18(17)15-21/h1-3,10-13,15,19H,4-9,14,16H2,(H,25,29) |
| InChIKey | NLRJQGZEJGTSMQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |