C24H26BrN3O3 — CID 50816811
N-[(3-bromophenyl)methyl]-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]acetamide (PubChem CID 50816811) has the molecular formula C24H26BrN3O3 and a molecular weight of 484.39 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | N-[(3-bromophenyl)methyl]-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 50816811 |
| Molecular Formula | C24H26BrN3O3 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-[1-(6-methoxy-1H-indole-2-carbonyl)piperidin-4-yl]acetamide |
| SMILES | COc1ccc2cc(C(=O)N3CCC(CC(=O)NCc4cccc(Br)c4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C24H26BrN3O3/c1-31-20-6-5-18-13-22(27-21(18)14-20)24(30)28-9-7-16(8-10-28)12-23(29)26-15-17-3-2-4-19(25)11-17/h2-6,11,13-14,16,27H,7-10,12,15H2,1H3,(H,26,29) |
| InChIKey | OYWMJBZHWGHWPA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |