About N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide
N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide (PubChem CID 5081913) has the molecular formula C15H8ClF6NO2
and a molecular weight of 383.68 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide |
| PubChem CID | 5081913 |
| Molecular Formula | C15H8ClF6NO2 |
| Molecular Weight | 383.68 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H8ClF6NO2/c16-9-1-2-12(24)11(6-9)13(25)23-10-4-7(14(17,18)19)3-8(5-10)15(20,21)22/h1-6,24H,(H,23,25) |
| InChIKey | CHILCFMQWMQVAL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide (CID 5081913) is N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide is O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(Cl)ccc1O.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide?
The InChIKey is CHILCFMQWMQVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8ClF6NO2/c16-9-1-2-12(24)11(6-9)13(25)23-10-4-7(14(17,18)19)3-8(5-10)15(20,21)22/h1-6,24H,(H,23,25).
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide?
N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide has a molecular weight of 383.68 g/mol, XLogP of 5.34, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide is sourced from PubChem (CID 5081913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).