About N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide
N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide (PubChem CID 50820529) has the molecular formula C25H24FN3O5S
and a molecular weight of 497.55 g/mol. Its IUPAC name is N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide.
Molecular Properties
| Compound Name | N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide |
| PubChem CID | 50820529 |
| Molecular Formula | C25H24FN3O5S |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide |
| SMILES | CCn1c(=O)n(CC)c2cc(S(=O)(=O)c3ccc(OC)cc3)c(NC(=O)c3cccc(F)c3)cc21 |
| InChI | InChI=1S/C25H24FN3O5S/c1-4-28-21-14-20(27-24(30)16-7-6-8-17(26)13-16)23(15-22(21)29(5-2)25(28)31)35(32,33)19-11-9-18(34-3)10-12-19/h6-15H,4-5H2,1-3H3,(H,27,30) |
| InChIKey | ZQBKVZLXMHVOFH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide?
The IUPAC name of N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide (CID 50820529) is N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide.
What is the SMILES notation for N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide?
The canonical SMILES for N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide is CCn1c(=O)n(CC)c2cc(S(=O)(=O)c3ccc(OC)cc3)c(NC(=O)c3cccc(F)c3)cc21.
What is the InChIKey of N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide?
The InChIKey is ZQBKVZLXMHVOFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24FN3O5S/c1-4-28-21-14-20(27-24(30)16-7-6-8-17(26)13-16)23(15-22(21)29(5-2)25(28)31)35(32,33)19-11-9-18(34-3)10-12-19/h6-15H,4-5H2,1-3H3,(H,27,30).
What are the key properties of N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide?
N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide has a molecular weight of 497.55 g/mol, XLogP of 4.08, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,3-diethyl-6-(4-methoxyphenyl)sulfonyl-2-oxobenzimidazol-5-yl]-3-fluorobenzamide is sourced from PubChem (CID 50820529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).