C21H29N3O4 — CID 5082068
4-butoxy-N-butyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]benzamide (PubChem CID 5082068) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-butoxy-N-butyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-butoxy-N-butyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 5082068 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 4-butoxy-N-butyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCCC)CC(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C21H29N3O4/c1-4-6-12-24(15-20(25)22-19-14-16(3)28-23-19)21(26)17-8-10-18(11-9-17)27-13-7-5-2/h8-11,14H,4-7,12-13,15H2,1-3H3,(H,22,23,25) |
| InChIKey | QPLMYCCETXVICG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|