C22H29N3O — CID 5082181
N,N-diethyl-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide (PubChem CID 5082181) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is N,N-diethyl-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide.
| Compound Name | N,N-diethyl-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide |
|---|---|
| PubChem CID | 5082181 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N,N-diethyl-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1nn(-c2ccccc2)c2c1C1CCC2(C)C1(C)C |
| InChI | InChI=1S/C22H29N3O/c1-6-24(7-2)20(26)18-17-16-13-14-22(5,21(16,3)4)19(17)25(23-18)15-11-9-8-10-12-15/h8-12,16H,6-7,13-14H2,1-5H3 |
| InChIKey | NPCBUTBQJRWYEU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |