C26H34N2O3S — CID 50822425
1-[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]-N-cyclohexylcyclopropane-1-carboxamide (PubChem CID 50822425) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is 1-[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]-N-cyclohexylcyclopropane-1-carboxamide.
| Compound Name | 1-[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]-N-cyclohexylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 50822425 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 1-[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]-N-cyclohexylcyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(C3(C(=O)NC4CCCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H34N2O3S/c1-25(2,3)19-11-15-23(16-12-19)32(30,31)28-22-13-9-20(10-14-22)26(17-18-26)24(29)27-21-7-5-4-6-8-21/h9-16,21,28H,4-8,17-18H2,1-3H3,(H,27,29) |
| InChIKey | GBJJBHFFMTYCPI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |