About methyl 4H-furo[3,2-b]pyrrole-5-carboxylate
methyl 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 5082263) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is methyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 5082263 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | methyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | COC(=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C8H7NO3/c1-11-8(10)6-4-7-5(9-6)2-3-12-7/h2-4,9H,1H3 |
| InChIKey | LIIJOCBTGRORSY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4H-furo[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of methyl 4H-furo[3,2-b]pyrrole-5-carboxylate (CID 5082263) is methyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for methyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for methyl 4H-furo[3,2-b]pyrrole-5-carboxylate is COC(=O)c1cc2occc2[nH]1.
What is the InChIKey of methyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The InChIKey is LIIJOCBTGRORSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c1-11-8(10)6-4-7-5(9-6)2-3-12-7/h2-4,9H,1H3.
What are the key properties of methyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
methyl 4H-furo[3,2-b]pyrrole-5-carboxylate has a molecular weight of 165.15 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4H-furo[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 5082263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).