methyl 4H-furo[3,2-b]pyrrole-5-carboxylate

C8H7NO3 — CID 5082263

IUPACmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate
SMILESCOC(=O)c1cc2occc2[nH]1
InChIInChI=1S/C8H7NO3/c1-11-8(10)6-4-7-5(9-6)2-3-12-7/h2-4,9H,1H3
InChIKeyLIIJOCBTGRORSY-UHFFFAOYSA-N
MW165.15 g/mol
LogP1.55
Rot. Bonds1

About methyl 4H-furo[3,2-b]pyrrole-5-carboxylate

methyl 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 5082263) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is methyl 4H-furo[3,2-b]pyrrole-5-carboxylate.

Molecular Properties

Compound Namemethyl 4H-furo[3,2-b]pyrrole-5-carboxylate
PubChem CID5082263
Molecular FormulaC8H7NO3
Molecular Weight165.15 g/mol
Exact Mass165.04
IUPAC Namemethyl 4H-furo[3,2-b]pyrrole-5-carboxylate
SMILESCOC(=O)c1cc2occc2[nH]1
InChIInChI=1S/C8H7NO3/c1-11-8(10)6-4-7-5(9-6)2-3-12-7/h2-4,9H,1H3
InChIKeyLIIJOCBTGRORSY-UHFFFAOYSA-N
XLogP1.55
TPSA55.23 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.15
LogP ≤ 51.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 4H-furo[3,2-b]pyrrole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of methyl 4H-furo[3,2-b]pyrrole-5-carboxylate (CID 5082263) is methyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for methyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for methyl 4H-furo[3,2-b]pyrrole-5-carboxylate is COC(=O)c1cc2occc2[nH]1.
What is the InChIKey of methyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The InChIKey is LIIJOCBTGRORSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c1-11-8(10)6-4-7-5(9-6)2-3-12-7/h2-4,9H,1H3.
What are the key properties of methyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
methyl 4H-furo[3,2-b]pyrrole-5-carboxylate has a molecular weight of 165.15 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4H-furo[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 5082263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).