About N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide
N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide (PubChem CID 5082266) has the molecular formula C16H15FN2OS
and a molecular weight of 302.37 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| PubChem CID | 5082266 |
| Molecular Formula | C16H15FN2OS |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| SMILES | CN1CCSc2ccc(C(=O)Nc3cccc(F)c3)cc21 |
| InChI | InChI=1S/C16H15FN2OS/c1-19-7-8-21-15-6-5-11(9-14(15)19)16(20)18-13-4-2-3-12(17)10-13/h2-6,9-10H,7-8H2,1H3,(H,18,20) |
| InChIKey | FRWDUPKKYSQCFI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide?
The IUPAC name of N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide (CID 5082266) is N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
What is the SMILES notation for N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide?
The canonical SMILES for N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide is CN1CCSc2ccc(C(=O)Nc3cccc(F)c3)cc21.
What is the InChIKey of N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide?
The InChIKey is FRWDUPKKYSQCFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2OS/c1-19-7-8-21-15-6-5-11(9-14(15)19)16(20)18-13-4-2-3-12(17)10-13/h2-6,9-10H,7-8H2,1H3,(H,18,20).
What are the key properties of N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide?
N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide has a molecular weight of 302.37 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide is sourced from PubChem (CID 5082266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).