C16H17NO5 — CID 5082328
6-[[carboxy(phenyl)methyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 5082328) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 6-[[carboxy(phenyl)methyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[carboxy(phenyl)methyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 5082328 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 6-[[carboxy(phenyl)methyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C(NC(=O)C1CC=CCC1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO5/c18-14(11-8-4-5-9-12(11)15(19)20)17-13(16(21)22)10-6-2-1-3-7-10/h1-7,11-13H,8-9H2,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | DALDXFQBUUHKBL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|