About N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide
N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide (PubChem CID 50824186) has the molecular formula C24H21F2N3O4S
and a molecular weight of 485.51 g/mol. Its IUPAC name is N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide |
| PubChem CID | 50824186 |
| Molecular Formula | C24H21F2N3O4S |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide |
| SMILES | CCn1c(=O)n(CC)c2cc(S(=O)(=O)c3ccccc3)c(NC(=O)c3c(F)cccc3F)cc21 |
| InChI | InChI=1S/C24H21F2N3O4S/c1-3-28-19-13-18(27-23(30)22-16(25)11-8-12-17(22)26)21(14-20(19)29(4-2)24(28)31)34(32,33)15-9-6-5-7-10-15/h5-14H,3-4H2,1-2H3,(H,27,30) |
| InChIKey | MILSZKXPOOYNMD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide?
The IUPAC name of N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide (CID 50824186) is N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide?
The canonical SMILES for N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide is CCn1c(=O)n(CC)c2cc(S(=O)(=O)c3ccccc3)c(NC(=O)c3c(F)cccc3F)cc21.
What is the InChIKey of N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide?
The InChIKey is MILSZKXPOOYNMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21F2N3O4S/c1-3-28-19-13-18(27-23(30)22-16(25)11-8-12-17(22)26)21(14-20(19)29(4-2)24(28)31)34(32,33)15-9-6-5-7-10-15/h5-14H,3-4H2,1-2H3,(H,27,30).
What are the key properties of N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide?
N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide has a molecular weight of 485.51 g/mol, XLogP of 4.21, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(benzenesulfonyl)-1,3-diethyl-2-oxobenzimidazol-5-yl]-2,6-difluorobenzamide is sourced from PubChem (CID 50824186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).