C23H17F2N3O5S — CID 50824297
3-fluoro-N-[7-(4-fluorophenyl)sulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide (PubChem CID 50824297) has the molecular formula C23H17F2N3O5S and a molecular weight of 485.47 g/mol. Its IUPAC name is 3-fluoro-N-[7-(4-fluorophenyl)sulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide.
| Compound Name | 3-fluoro-N-[7-(4-fluorophenyl)sulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide |
|---|---|
| PubChem CID | 50824297 |
| Molecular Formula | C23H17F2N3O5S |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 3-fluoro-N-[7-(4-fluorophenyl)sulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]benzamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(S(=O)(=O)c3ccc(F)cc3)c(NC(=O)c3cccc(F)c3)cc21 |
| InChI | InChI=1S/C23H17F2N3O5S/c1-27-18-11-17(26-21(29)13-4-3-5-15(25)10-13)20(12-19(18)28(2)23(31)22(27)30)34(32,33)16-8-6-14(24)7-9-16/h3-12H,1-2H3,(H,26,29) |
| InChIKey | VCXIDPNBWNYQMP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|