C21H27N5O2S — CID 50826029
1-[6-(2-anilino-2-oxoethyl)sulfanylpyridazin-3-yl]-N-propan-2-ylpiperidine-4-carboxamide (PubChem CID 50826029) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is 1-[6-(2-anilino-2-oxoethyl)sulfanylpyridazin-3-yl]-N-propan-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-[6-(2-anilino-2-oxoethyl)sulfanylpyridazin-3-yl]-N-propan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 50826029 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-[6-(2-anilino-2-oxoethyl)sulfanylpyridazin-3-yl]-N-propan-2-ylpiperidine-4-carboxamide |
| SMILES | CC(C)NC(=O)C1CCN(c2ccc(SCC(=O)Nc3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C21H27N5O2S/c1-15(2)22-21(28)16-10-12-26(13-11-16)18-8-9-20(25-24-18)29-14-19(27)23-17-6-4-3-5-7-17/h3-9,15-16H,10-14H2,1-2H3,(H,22,28)(H,23,27) |
| InChIKey | URSGIZHIMQXSEG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |