C26H23FN4O — CID 50826661
3-[[5-(4-fluorophenyl)pyrimidin-2-yl]amino]-N-[1-(4-methylphenyl)ethyl]benzamide (PubChem CID 50826661) has the molecular formula C26H23FN4O and a molecular weight of 426.50 g/mol. Its IUPAC name is 3-[[5-(4-fluorophenyl)pyrimidin-2-yl]amino]-N-[1-(4-methylphenyl)ethyl]benzamide.
| Compound Name | 3-[[5-(4-fluorophenyl)pyrimidin-2-yl]amino]-N-[1-(4-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 50826661 |
| Molecular Formula | C26H23FN4O |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-[[5-(4-fluorophenyl)pyrimidin-2-yl]amino]-N-[1-(4-methylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2cccc(Nc3ncc(-c4ccc(F)cc4)cn3)c2)cc1 |
| InChI | InChI=1S/C26H23FN4O/c1-17-6-8-19(9-7-17)18(2)30-25(32)21-4-3-5-24(14-21)31-26-28-15-22(16-29-26)20-10-12-23(27)13-11-20/h3-16,18H,1-2H3,(H,30,32)(H,28,29,31) |
| InChIKey | ZCKGWIHGZOQRQH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |