C21H27FN6S — CID 50829803
N-tert-butyl-6-(3-fluorophenyl)-2-(4-prop-2-enylpiperazin-1-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine (PubChem CID 50829803) has the molecular formula C21H27FN6S and a molecular weight of 414.55 g/mol. Its IUPAC name is N-tert-butyl-6-(3-fluorophenyl)-2-(4-prop-2-enylpiperazin-1-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine.
| Compound Name | N-tert-butyl-6-(3-fluorophenyl)-2-(4-prop-2-enylpiperazin-1-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine |
|---|---|
| PubChem CID | 50829803 |
| Molecular Formula | C21H27FN6S |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-tert-butyl-6-(3-fluorophenyl)-2-(4-prop-2-enylpiperazin-1-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine |
| SMILES | C=CCN1CCN(c2nn3c(NC(C)(C)C)c(-c4cccc(F)c4)nc3s2)CC1 |
| InChI | InChI=1S/C21H27FN6S/c1-5-9-26-10-12-27(13-11-26)20-25-28-18(24-21(2,3)4)17(23-19(28)29-20)15-7-6-8-16(22)14-15/h5-8,14,24H,1,9-13H2,2-4H3 |
| InChIKey | PEQWPROQFWEITM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 48.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|