C22H27FN6S — CID 50829869
N-cyclopentyl-6-(3-fluorophenyl)-2-(4-prop-2-enylpiperazin-1-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine (PubChem CID 50829869) has the molecular formula C22H27FN6S and a molecular weight of 426.57 g/mol. Its IUPAC name is N-cyclopentyl-6-(3-fluorophenyl)-2-(4-prop-2-enylpiperazin-1-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine.
| Compound Name | N-cyclopentyl-6-(3-fluorophenyl)-2-(4-prop-2-enylpiperazin-1-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine |
|---|---|
| PubChem CID | 50829869 |
| Molecular Formula | C22H27FN6S |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | N-cyclopentyl-6-(3-fluorophenyl)-2-(4-prop-2-enylpiperazin-1-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine |
| SMILES | C=CCN1CCN(c2nn3c(NC4CCCC4)c(-c4cccc(F)c4)nc3s2)CC1 |
| InChI | InChI=1S/C22H27FN6S/c1-2-10-27-11-13-28(14-12-27)22-26-29-20(24-18-8-3-4-9-18)19(25-21(29)30-22)16-6-5-7-17(23)15-16/h2,5-7,15,18,24H,1,3-4,8-14H2 |
| InChIKey | KTMFBVURIRPVTE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 48.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|