C18H20N2O5 — CID 5083053
2-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropyl]isoindole-1,3-dione (PubChem CID 5083053) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 5083053 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-oxopropyl]isoindole-1,3-dione |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C18H20N2O5/c21-15(19-9-6-18(7-10-19)24-11-12-25-18)5-8-20-16(22)13-3-1-2-4-14(13)17(20)23/h1-4H,5-12H2 |
| InChIKey | WQCXRWWGHBQTQC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|