About N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide
N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide (PubChem CID 50831579) has the molecular formula C21H15ClFNO2S
and a molecular weight of 399.87 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide.
Molecular Properties
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide |
| PubChem CID | 50831579 |
| Molecular Formula | C21H15ClFNO2S |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide |
| SMILES | Cc1sc2cc(-c3ccccc3)oc2c1C(=O)NCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H15ClFNO2S/c1-12-19(21(25)24-11-14-7-8-15(23)9-16(14)22)20-18(27-12)10-17(26-20)13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,24,25) |
| InChIKey | WUNSYFFLIRQXQQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide?
The IUPAC name of N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide (CID 50831579) is N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide.
What is the SMILES notation for N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide?
The canonical SMILES for N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide is Cc1sc2cc(-c3ccccc3)oc2c1C(=O)NCc1ccc(F)cc1Cl.
What is the InChIKey of N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide?
The InChIKey is WUNSYFFLIRQXQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClFNO2S/c1-12-19(21(25)24-11-14-7-8-15(23)9-16(14)22)20-18(27-12)10-17(26-20)13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,24,25).
What are the key properties of N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide?
N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide has a molecular weight of 399.87 g/mol, XLogP of 6.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-4-fluorophenyl)methyl]-5-methyl-2-phenylthieno[3,2-b]furan-6-carboxamide is sourced from PubChem (CID 50831579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).