C21H20F2N4O2 — CID 50834576
2-[4-(cyclopentylamino)-2-oxoquinazolin-1-yl]-N-(3,5-difluorophenyl)acetamide (PubChem CID 50834576) has the molecular formula C21H20F2N4O2 and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-[4-(cyclopentylamino)-2-oxoquinazolin-1-yl]-N-(3,5-difluorophenyl)acetamide.
| Compound Name | 2-[4-(cyclopentylamino)-2-oxoquinazolin-1-yl]-N-(3,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 50834576 |
| Molecular Formula | C21H20F2N4O2 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[4-(cyclopentylamino)-2-oxoquinazolin-1-yl]-N-(3,5-difluorophenyl)acetamide |
| SMILES | O=C(Cn1c(=O)nc(NC2CCCC2)c2ccccc21)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C21H20F2N4O2/c22-13-9-14(23)11-16(10-13)24-19(28)12-27-18-8-4-3-7-17(18)20(26-21(27)29)25-15-5-1-2-6-15/h3-4,7-11,15H,1-2,5-6,12H2,(H,24,28)(H,25,26,29) |
| InChIKey | MLQJZUYTAFKATK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |