C23H30N6O2S2 — CID 50834676
3-(4-ethyl-5-ethylsulfanyl-1,2,4-triazol-3-yl)-1-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine (PubChem CID 50834676) has the molecular formula C23H30N6O2S2 and a molecular weight of 486.67 g/mol. Its IUPAC name is 3-(4-ethyl-5-ethylsulfanyl-1,2,4-triazol-3-yl)-1-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine.
| Compound Name | 3-(4-ethyl-5-ethylsulfanyl-1,2,4-triazol-3-yl)-1-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 50834676 |
| Molecular Formula | C23H30N6O2S2 |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-(4-ethyl-5-ethylsulfanyl-1,2,4-triazol-3-yl)-1-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine |
| SMILES | CCSc1nnc(-c2nn(C)c3c2CN(S(=O)(=O)c2ccc4c(c2)CCCC4)CC3)n1CC |
| InChI | InChI=1S/C23H30N6O2S2/c1-4-29-22(24-25-23(29)32-5-2)21-19-15-28(13-12-20(19)27(3)26-21)33(30,31)18-11-10-16-8-6-7-9-17(16)14-18/h10-11,14H,4-9,12-13,15H2,1-3H3 |
| InChIKey | DTZMOSRDYFJSQF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |