About 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide
5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide (PubChem CID 50835080) has the molecular formula C19H22N2O2S3
and a molecular weight of 406.60 g/mol. Its IUPAC name is 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide.
Molecular Properties
| Compound Name | 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide |
| PubChem CID | 50835080 |
| Molecular Formula | C19H22N2O2S3 |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide |
| SMILES | Cc1nc(-c2cc(S(=O)(=O)NCC(C)c3ccccc3)c(C)s2)sc1C |
| InChI | InChI=1S/C19H22N2O2S3/c1-12(16-8-6-5-7-9-16)11-20-26(22,23)18-10-17(24-15(18)4)19-21-13(2)14(3)25-19/h5-10,12,20H,11H2,1-4H3 |
| InChIKey | RUDLUBLHIOADOD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide?
The IUPAC name of 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide (CID 50835080) is 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide.
What is the SMILES notation for 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide?
The canonical SMILES for 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide is Cc1nc(-c2cc(S(=O)(=O)NCC(C)c3ccccc3)c(C)s2)sc1C.
What is the InChIKey of 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide?
The InChIKey is RUDLUBLHIOADOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2S3/c1-12(16-8-6-5-7-9-16)11-20-26(22,23)18-10-17(24-15(18)4)19-21-13(2)14(3)25-19/h5-10,12,20H,11H2,1-4H3.
What are the key properties of 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide?
5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide has a molecular weight of 406.60 g/mol, XLogP of 4.88, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methyl-N-(2-phenylpropyl)thiophene-3-sulfonamide is sourced from PubChem (CID 50835080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).