C26H23N3O5S — CID 50835924
2-(3-phenoxypyrazin-2-yl)sulfanyl-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 50835924) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is 2-(3-phenoxypyrazin-2-yl)sulfanyl-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 2-(3-phenoxypyrazin-2-yl)sulfanyl-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 50835924 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-(3-phenoxypyrazin-2-yl)sulfanyl-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2Sc2nccnc2Oc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H23N3O5S/c1-31-20-15-17(16-21(32-2)23(20)33-3)29-24(30)19-11-7-8-12-22(19)35-26-25(27-13-14-28-26)34-18-9-5-4-6-10-18/h4-16H,1-3H3,(H,29,30) |
| InChIKey | PVSKFXWVUPXRFJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |