C32H40N4Si2 — CID 5083696
3,3,6,6-tetraethyl-1,2,4,5-tetraphenyl-1,2,4,5,3,6-tetrazadisilinane (PubChem CID 5083696) has the molecular formula C32H40N4Si2 and a molecular weight of 536.87 g/mol. Its IUPAC name is 3,3,6,6-tetraethyl-1,2,4,5-tetraphenyl-1,2,4,5,3,6-tetrazadisilinane.
| Compound Name | 3,3,6,6-tetraethyl-1,2,4,5-tetraphenyl-1,2,4,5,3,6-tetrazadisilinane |
|---|---|
| PubChem CID | 5083696 |
| Molecular Formula | C32H40N4Si2 |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 3,3,6,6-tetraethyl-1,2,4,5-tetraphenyl-1,2,4,5,3,6-tetrazadisilinane |
| SMILES | CC[Si]1(CC)N(c2ccccc2)N(c2ccccc2)[Si](CC)(CC)N(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C32H40N4Si2/c1-5-37(6-2)33(29-21-13-9-14-22-29)35(31-25-17-11-18-26-31)38(7-3,8-4)36(32-27-19-12-20-28-32)34(37)30-23-15-10-16-24-30/h9-28H,5-8H2,1-4H3 |
| InChIKey | ZMQGXJHACXDDPO-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|