C22H25N5O5S — CID 50837254
N-[[4-(dimethylamino)phenyl]methyl]-5-(4-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 50837254) has the molecular formula C22H25N5O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-5-(4-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-5-(4-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 50837254 |
| Molecular Formula | C22H25N5O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-5-(4-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2nnc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)o2)cc1 |
| InChI | InChI=1S/C22H25N5O5S/c1-26(2)18-7-3-16(4-8-18)15-23-20(28)22-25-24-21(32-22)17-5-9-19(10-6-17)33(29,30)27-11-13-31-14-12-27/h3-10H,11-15H2,1-2H3,(H,23,28) |
| InChIKey | LOSJQXKLGLNXAN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|