C26H35Cl2N5 — CID 508390
N'-[[4-[(5,6-dichloro-2-piperidin-4-ylbenzimidazol-1-yl)methyl]phenyl]methyl]hexane-1,6-diamine (PubChem CID 508390) has the molecular formula C26H35Cl2N5 and a molecular weight of 488.51 g/mol. Its IUPAC name is N'-[[4-[(5,6-dichloro-2-piperidin-4-ylbenzimidazol-1-yl)methyl]phenyl]methyl]hexane-1,6-diamine.
| Compound Name | N'-[[4-[(5,6-dichloro-2-piperidin-4-ylbenzimidazol-1-yl)methyl]phenyl]methyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 508390 |
| Molecular Formula | C26H35Cl2N5 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N'-[[4-[(5,6-dichloro-2-piperidin-4-ylbenzimidazol-1-yl)methyl]phenyl]methyl]hexane-1,6-diamine |
| SMILES | NCCCCCCNCc1ccc(Cn2c(C3CCNCC3)nc3cc(Cl)c(Cl)cc32)cc1 |
| InChI | InChI=1S/C26H35Cl2N5/c27-22-15-24-25(16-23(22)28)33(26(32-24)21-9-13-30-14-10-21)18-20-7-5-19(6-8-20)17-31-12-4-2-1-3-11-29/h5-8,15-16,21,30-31H,1-4,9-14,17-18,29H2 |
| InChIKey | YKVZNBNWQZZUJD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|