About 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide
4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide (PubChem CID 50839083) has the molecular formula C16H18N2O2S4
and a molecular weight of 398.60 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide |
| PubChem CID | 50839083 |
| Molecular Formula | C16H18N2O2S4 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1cc(-c2nc(C)c(C)s2)cs1)c1cccs1 |
| InChI | InChI=1S/C16H18N2O2S4/c1-4-13(14-6-5-7-21-14)18-24(19,20)15-8-12(9-22-15)16-17-10(2)11(3)23-16/h5-9,13,18H,4H2,1-3H3 |
| InChIKey | MERYNBCOTRACBU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide?
The IUPAC name of 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide (CID 50839083) is 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide.
What is the SMILES notation for 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide?
The canonical SMILES for 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide is CCC(NS(=O)(=O)c1cc(-c2nc(C)c(C)s2)cs1)c1cccs1.
What is the InChIKey of 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide?
The InChIKey is MERYNBCOTRACBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S4/c1-4-13(14-6-5-7-21-14)18-24(19,20)15-8-12(9-22-15)16-17-10(2)11(3)23-16/h5-9,13,18H,4H2,1-3H3.
What are the key properties of 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide?
4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide has a molecular weight of 398.60 g/mol, XLogP of 4.98, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(1-thiophen-2-ylpropyl)thiophene-2-sulfonamide is sourced from PubChem (CID 50839083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).