About [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone
[1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 50839462) has the molecular formula C24H28N4OS
and a molecular weight of 420.58 g/mol. Its IUPAC name is [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone |
| PubChem CID | 50839462 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | Cc1cc2c(N3CCCC(C(=O)N4CCN(c5ccccc5)CC4)C3)nccc2s1 |
| InChI | InChI=1S/C24H28N4OS/c1-18-16-21-22(30-18)9-10-25-23(21)28-11-5-6-19(17-28)24(29)27-14-12-26(13-15-27)20-7-3-2-4-8-20/h2-4,7-10,16,19H,5-6,11-15,17H2,1H3 |
| InChIKey | YNYIFUPEQFAQJP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone?
The IUPAC name of [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone (CID 50839462) is [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone.
What is the SMILES notation for [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone?
The canonical SMILES for [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone is Cc1cc2c(N3CCCC(C(=O)N4CCN(c5ccccc5)CC4)C3)nccc2s1.
What is the InChIKey of [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone?
The InChIKey is YNYIFUPEQFAQJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4OS/c1-18-16-21-22(30-18)9-10-25-23(21)28-11-5-6-19(17-28)24(29)27-14-12-26(13-15-27)20-7-3-2-4-8-20/h2-4,7-10,16,19H,5-6,11-15,17H2,1H3.
What are the key properties of [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone?
[1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone has a molecular weight of 420.58 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone is sourced from PubChem (CID 50839462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).