C19H20F2N4O2S — CID 50840577
2-[(3,5-difluorophenyl)methylamino]-N,N-diethylquinoxaline-6-sulfonamide (PubChem CID 50840577) has the molecular formula C19H20F2N4O2S and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methylamino]-N,N-diethylquinoxaline-6-sulfonamide.
| Compound Name | 2-[(3,5-difluorophenyl)methylamino]-N,N-diethylquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 50840577 |
| Molecular Formula | C19H20F2N4O2S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methylamino]-N,N-diethylquinoxaline-6-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nc(NCc3cc(F)cc(F)c3)cnc2c1 |
| InChI | InChI=1S/C19H20F2N4O2S/c1-3-25(4-2)28(26,27)16-5-6-17-18(10-16)22-12-19(24-17)23-11-13-7-14(20)9-15(21)8-13/h5-10,12H,3-4,11H2,1-2H3,(H,23,24) |
| InChIKey | LPKNXZLDQWQQSB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |