About 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine
5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine (PubChem CID 50840637) has the molecular formula C17H20N4O4S
and a molecular weight of 376.44 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine |
| PubChem CID | 50840637 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine |
| SMILES | Nc1nc(N2CCC3(CC2)OCCO3)ncc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20N4O4S/c18-15-14(26(22,23)13-4-2-1-3-5-13)12-19-16(20-15)21-8-6-17(7-9-21)24-10-11-25-17/h1-5,12H,6-11H2,(H2,18,19,20) |
| InChIKey | AIIZZDBOXYBNLU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine?
The IUPAC name of 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine (CID 50840637) is 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine.
What is the SMILES notation for 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine?
The canonical SMILES for 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine is Nc1nc(N2CCC3(CC2)OCCO3)ncc1S(=O)(=O)c1ccccc1.
What is the InChIKey of 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine?
The InChIKey is AIIZZDBOXYBNLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O4S/c18-15-14(26(22,23)13-4-2-1-3-5-13)12-19-16(20-15)21-8-6-17(7-9-21)24-10-11-25-17/h1-5,12H,6-11H2,(H2,18,19,20).
What are the key properties of 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine?
5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine has a molecular weight of 376.44 g/mol, XLogP of 1.23, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-amine is sourced from PubChem (CID 50840637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).