About 4-benzylsulfanylaniline
4-benzylsulfanylaniline (PubChem CID 5084145) has the molecular formula C13H13NS
and a molecular weight of 215.32 g/mol. Its IUPAC name is 4-benzylsulfanylaniline.
Molecular Properties
| Compound Name | 4-benzylsulfanylaniline |
| PubChem CID | 5084145 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4-benzylsulfanylaniline |
| SMILES | Nc1ccc(SCc2ccccc2)cc1 |
| InChI | InChI=1S/C13H13NS/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
| InChIKey | ARKMPBRPOSHHJR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-benzylsulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylsulfanylaniline?
The IUPAC name of 4-benzylsulfanylaniline (CID 5084145) is 4-benzylsulfanylaniline.
What is the SMILES notation for 4-benzylsulfanylaniline?
The canonical SMILES for 4-benzylsulfanylaniline is Nc1ccc(SCc2ccccc2)cc1.
What is the InChIKey of 4-benzylsulfanylaniline?
The InChIKey is ARKMPBRPOSHHJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NS/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9H,10,14H2.
What are the key properties of 4-benzylsulfanylaniline?
4-benzylsulfanylaniline has a molecular weight of 215.32 g/mol, XLogP of 3.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylsulfanylaniline is sourced from PubChem (CID 5084145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).