C22H26N4O3S — CID 50842176
2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide (PubChem CID 50842176) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50842176 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide |
| SMILES | Cc1ccc(-c2noc(-c3ccccc3S(=O)(=O)NCCCN3CCCC3)n2)cc1 |
| InChI | InChI=1S/C22H26N4O3S/c1-17-9-11-18(12-10-17)21-24-22(29-25-21)19-7-2-3-8-20(19)30(27,28)23-13-6-16-26-14-4-5-15-26/h2-3,7-12,23H,4-6,13-16H2,1H3 |
| InChIKey | ZJEGCJLJVVRNOT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|