C23H29N5O2 — CID 50842297
1-[3-[(3,4-dimethylphenyl)carbamoylamino]-2-pyridinyl]-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 50842297) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-[3-[(3,4-dimethylphenyl)carbamoylamino]-2-pyridinyl]-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | 1-[3-[(3,4-dimethylphenyl)carbamoylamino]-2-pyridinyl]-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 50842297 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-[3-[(3,4-dimethylphenyl)carbamoylamino]-2-pyridinyl]-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCNC(=O)C1CCN(c2ncccc2NC(=O)Nc2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C23H29N5O2/c1-4-11-25-22(29)18-9-13-28(14-10-18)21-20(6-5-12-24-21)27-23(30)26-19-8-7-16(2)17(3)15-19/h4-8,12,15,18H,1,9-11,13-14H2,2-3H3,(H,25,29)(H2,26,27,30) |
| InChIKey | YUNWOBPOEAIJLY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|