C16H19N3O3 — CID 50842476
7-acetamido-N-(2-methoxyethyl)-2-methylquinoline-5-carboxamide (PubChem CID 50842476) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 7-acetamido-N-(2-methoxyethyl)-2-methylquinoline-5-carboxamide.
| Compound Name | 7-acetamido-N-(2-methoxyethyl)-2-methylquinoline-5-carboxamide |
|---|---|
| PubChem CID | 50842476 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 7-acetamido-N-(2-methoxyethyl)-2-methylquinoline-5-carboxamide |
| SMILES | COCCNC(=O)c1cc(NC(C)=O)cc2nc(C)ccc12 |
| InChI | InChI=1S/C16H19N3O3/c1-10-4-5-13-14(16(21)17-6-7-22-3)8-12(19-11(2)20)9-15(13)18-10/h4-5,8-9H,6-7H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | JTCCWKHRXPCIFK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|