C16H12F2N2O3S — CID 50843837
3-[2-(benzenesulfonyl)ethyl]-5-(3,5-difluorophenyl)-1,2,4-oxadiazole (PubChem CID 50843837) has the molecular formula C16H12F2N2O3S and a molecular weight of 350.35 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)ethyl]-5-(3,5-difluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-[2-(benzenesulfonyl)ethyl]-5-(3,5-difluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 50843837 |
| Molecular Formula | C16H12F2N2O3S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 3-[2-(benzenesulfonyl)ethyl]-5-(3,5-difluorophenyl)-1,2,4-oxadiazole |
| SMILES | O=S(=O)(CCc1noc(-c2cc(F)cc(F)c2)n1)c1ccccc1 |
| InChI | InChI=1S/C16H12F2N2O3S/c17-12-8-11(9-13(18)10-12)16-19-15(20-23-16)6-7-24(21,22)14-4-2-1-3-5-14/h1-5,8-10H,6-7H2 |
| InChIKey | CNZGIBSNXLYBLA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |