About 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole
3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole (PubChem CID 50844311) has the molecular formula C17H15FN2O3S
and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole |
| PubChem CID | 50844311 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole |
| SMILES | O=S(=O)(CCc1noc(Cc2cccc(F)c2)n1)c1ccccc1 |
| InChI | InChI=1S/C17H15FN2O3S/c18-14-6-4-5-13(11-14)12-17-19-16(20-23-17)9-10-24(21,22)15-7-2-1-3-8-15/h1-8,11H,9-10,12H2 |
| InChIKey | DPFLIKHTUDVYMX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole?
The IUPAC name of 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole (CID 50844311) is 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole.
What is the SMILES notation for 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole?
The canonical SMILES for 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole is O=S(=O)(CCc1noc(Cc2cccc(F)c2)n1)c1ccccc1.
What is the InChIKey of 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole?
The InChIKey is DPFLIKHTUDVYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN2O3S/c18-14-6-4-5-13(11-14)12-17-19-16(20-23-17)9-10-24(21,22)15-7-2-1-3-8-15/h1-8,11H,9-10,12H2.
What are the key properties of 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole?
3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole has a molecular weight of 346.38 g/mol, XLogP of 2.82, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(benzenesulfonyl)ethyl]-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole is sourced from PubChem (CID 50844311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).