C17H21FN2O3 — CID 50844702
4-ethoxy-6-fluoro-N-(3-methoxypropyl)-8-methylquinoline-2-carboxamide (PubChem CID 50844702) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is 4-ethoxy-6-fluoro-N-(3-methoxypropyl)-8-methylquinoline-2-carboxamide.
| Compound Name | 4-ethoxy-6-fluoro-N-(3-methoxypropyl)-8-methylquinoline-2-carboxamide |
|---|---|
| PubChem CID | 50844702 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-ethoxy-6-fluoro-N-(3-methoxypropyl)-8-methylquinoline-2-carboxamide |
| SMILES | CCOc1cc(C(=O)NCCCOC)nc2c(C)cc(F)cc12 |
| InChI | InChI=1S/C17H21FN2O3/c1-4-23-15-10-14(17(21)19-6-5-7-22-3)20-16-11(2)8-12(18)9-13(15)16/h8-10H,4-7H2,1-3H3,(H,19,21) |
| InChIKey | BIYKCBFLXJCAMR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|