About [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone
[4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 50846501) has the molecular formula C19H19N3O2S
and a molecular weight of 353.45 g/mol. Its IUPAC name is [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone |
| PubChem CID | 50846501 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCC(Cc2nnc(-c3ccccc3)o2)CC1 |
| InChI | InChI=1S/C19H19N3O2S/c23-19(16-7-4-12-25-16)22-10-8-14(9-11-22)13-17-20-21-18(24-17)15-5-2-1-3-6-15/h1-7,12,14H,8-11,13H2 |
| InChIKey | HZSYMKWBPMPKFC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone?
The IUPAC name of [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone (CID 50846501) is [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone.
What is the SMILES notation for [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone?
The canonical SMILES for [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone is O=C(c1cccs1)N1CCC(Cc2nnc(-c3ccccc3)o2)CC1.
What is the InChIKey of [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone?
The InChIKey is HZSYMKWBPMPKFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O2S/c23-19(16-7-4-12-25-16)22-10-8-14(9-11-22)13-17-20-21-18(24-17)15-5-2-1-3-6-15/h1-7,12,14H,8-11,13H2.
What are the key properties of [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone?
[4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone has a molecular weight of 353.45 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]piperidin-1-yl]-thiophen-2-ylmethanone is sourced from PubChem (CID 50846501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).