C21H22N6O2 — CID 50847202
N-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-3-pyrimidin-4-yl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 50847202) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is N-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-3-pyrimidin-4-yl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-3-pyrimidin-4-yl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 50847202 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-3-pyrimidin-4-yl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCCN1CC=C(c2ccccc2)CC1)c1nc(-c2ccncn2)no1 |
| InChI | InChI=1S/C21H22N6O2/c28-20(21-25-19(26-29-21)18-7-11-22-15-24-18)23-10-4-12-27-13-8-17(9-14-27)16-5-2-1-3-6-16/h1-3,5-8,11,15H,4,9-10,12-14H2,(H,23,28) |
| InChIKey | NQCKPVIUPKMYFJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|