About 3-nitro-1H-1,5-benzodiazepine
3-nitro-1H-1,5-benzodiazepine (PubChem CID 5084829) has the molecular formula C9H7N3O2
and a molecular weight of 189.17 g/mol. Its IUPAC name is 3-nitro-1H-1,5-benzodiazepine.
Molecular Properties
| Compound Name | 3-nitro-1H-1,5-benzodiazepine |
| PubChem CID | 5084829 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 3-nitro-1H-1,5-benzodiazepine |
| SMILES | O=[N+]([O-])C1=CNc2ccccc2N=C1 |
| InChI | InChI=1S/C9H7N3O2/c13-12(14)7-5-10-8-3-1-2-4-9(8)11-6-7/h1-6,10H |
| InChIKey | PHEJNNZKCKVHQU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-1H-1,5-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-1H-1,5-benzodiazepine?
The IUPAC name of 3-nitro-1H-1,5-benzodiazepine (CID 5084829) is 3-nitro-1H-1,5-benzodiazepine.
What is the SMILES notation for 3-nitro-1H-1,5-benzodiazepine?
The canonical SMILES for 3-nitro-1H-1,5-benzodiazepine is O=[N+]([O-])C1=CNc2ccccc2N=C1.
What is the InChIKey of 3-nitro-1H-1,5-benzodiazepine?
The InChIKey is PHEJNNZKCKVHQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c13-12(14)7-5-10-8-3-1-2-4-9(8)11-6-7/h1-6,10H.
What are the key properties of 3-nitro-1H-1,5-benzodiazepine?
3-nitro-1H-1,5-benzodiazepine has a molecular weight of 189.17 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-1H-1,5-benzodiazepine is sourced from PubChem (CID 5084829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).