About 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine
1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine (PubChem CID 50848397) has the molecular formula C19H28F2N2O2S
and a molecular weight of 386.51 g/mol. Its IUPAC name is 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine.
Molecular Properties
| Compound Name | 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine |
| PubChem CID | 50848397 |
| Molecular Formula | C19H28F2N2O2S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine |
| SMILES | CC1CCCN(CC2CCN(S(=O)(=O)Cc3cc(F)cc(F)c3)CC2)C1 |
| InChI | InChI=1S/C19H28F2N2O2S/c1-15-3-2-6-22(12-15)13-16-4-7-23(8-5-16)26(24,25)14-17-9-18(20)11-19(21)10-17/h9-11,15-16H,2-8,12-14H2,1H3 |
| InChIKey | ZGWNCQYAGADGHB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine?
The IUPAC name of 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine (CID 50848397) is 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine.
What is the SMILES notation for 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine?
The canonical SMILES for 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine is CC1CCCN(CC2CCN(S(=O)(=O)Cc3cc(F)cc(F)c3)CC2)C1.
What is the InChIKey of 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine?
The InChIKey is ZGWNCQYAGADGHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28F2N2O2S/c1-15-3-2-6-22(12-15)13-16-4-7-23(8-5-16)26(24,25)14-17-9-18(20)11-19(21)10-17/h9-11,15-16H,2-8,12-14H2,1H3.
What are the key properties of 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine?
1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine has a molecular weight of 386.51 g/mol, XLogP of 3.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]methyl]-3-methylpiperidine is sourced from PubChem (CID 50848397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).