C14H7Cl2NO2 — CID 50850274
3-(5,7-dichloro-1,3-benzoxazol-2-yl)benzaldehyde (PubChem CID 50850274) has the molecular formula C14H7Cl2NO2 and a molecular weight of 292.12 g/mol. Its IUPAC name is 3-(5,7-dichloro-1,3-benzoxazol-2-yl)benzaldehyde.
| Compound Name | 3-(5,7-dichloro-1,3-benzoxazol-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 50850274 |
| Molecular Formula | C14H7Cl2NO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 3-(5,7-dichloro-1,3-benzoxazol-2-yl)benzaldehyde |
| SMILES | O=Cc1cccc(-c2nc3cc(Cl)cc(Cl)c3o2)c1 |
| InChI | InChI=1S/C14H7Cl2NO2/c15-10-5-11(16)13-12(6-10)17-14(19-13)9-3-1-2-8(4-9)7-18/h1-7H |
| InChIKey | KEMAEHUKJVMVKL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|