C17H20N6O2S — CID 50850392
2-[4-[3-[2-(dimethylamino)-2-oxoethyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-N,N-dimethylacetamide (PubChem CID 50850392) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-[4-[3-[2-(dimethylamino)-2-oxoethyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[3-[2-(dimethylamino)-2-oxoethyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 50850392 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-[4-[3-[2-(dimethylamino)-2-oxoethyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1ccc(-c2nn3c(CC(=O)N(C)C)nnc3s2)cc1 |
| InChI | InChI=1S/C17H20N6O2S/c1-21(2)14(24)9-11-5-7-12(8-6-11)16-20-23-13(10-15(25)22(3)4)18-19-17(23)26-16/h5-8H,9-10H2,1-4H3 |
| InChIKey | QDFPKVZWMFWYCP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |