C18H14Cl2N2O3 — CID 50850765
[3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]-morpholin-4-ylmethanone (PubChem CID 50850765) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is [3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]-morpholin-4-ylmethanone.
| Compound Name | [3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 50850765 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | [3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cccc(-c2nc3cc(Cl)cc(Cl)c3o2)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H14Cl2N2O3/c19-13-9-14(20)16-15(10-13)21-17(25-16)11-2-1-3-12(8-11)18(23)22-4-6-24-7-5-22/h1-3,8-10H,4-7H2 |
| InChIKey | IFCNQCSWGFXXTB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |