About 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine
2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine (PubChem CID 50851943) has the molecular formula C22H28ClN5S
and a molecular weight of 430.02 g/mol. Its IUPAC name is 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine.
Molecular Properties
| Compound Name | 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine |
| PubChem CID | 50851943 |
| Molecular Formula | C22H28ClN5S |
| Molecular Weight | 430.02 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine |
| SMILES | NC(N)=NCCCN1CCN(C2Cc3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C22H28ClN5S/c23-17-6-7-21-18(15-17)19(14-16-4-1-2-5-20(16)29-21)28-12-10-27(11-13-28)9-3-8-26-22(24)25/h1-2,4-7,15,19H,3,8-14H2,(H4,24,25,26) |
| InChIKey | PWBJRWSFIGVHCH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.02 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine?
The IUPAC name of 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine (CID 50851943) is 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine.
What is the SMILES notation for 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine?
The canonical SMILES for 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine is NC(N)=NCCCN1CCN(C2Cc3ccccc3Sc3ccc(Cl)cc32)CC1.
What is the InChIKey of 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine?
The InChIKey is PWBJRWSFIGVHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28ClN5S/c23-17-6-7-21-18(15-17)19(14-16-4-1-2-5-20(16)29-21)28-12-10-27(11-13-28)9-3-8-26-22(24)25/h1-2,4-7,15,19H,3,8-14H2,(H4,24,25,26).
What are the key properties of 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine?
2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine has a molecular weight of 430.02 g/mol, XLogP of 3.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]propyl]guanidine is sourced from PubChem (CID 50851943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).