About 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one
4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one (PubChem CID 50851956) has the molecular formula C18H17ClN2OS
and a molecular weight of 344.87 g/mol. Its IUPAC name is 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one.
Molecular Properties
| Compound Name | 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one |
| PubChem CID | 50851956 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one |
| SMILES | O=C1CN(C2Cc3ccccc3Sc3ccc(Cl)cc32)CCN1 |
| InChI | InChI=1S/C18H17ClN2OS/c19-13-5-6-17-14(10-13)15(21-8-7-20-18(22)11-21)9-12-3-1-2-4-16(12)23-17/h1-6,10,15H,7-9,11H2,(H,20,22) |
| InChIKey | PNIAPNIOQWLLFL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one?
The IUPAC name of 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one (CID 50851956) is 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one.
What is the SMILES notation for 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one?
The canonical SMILES for 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one is O=C1CN(C2Cc3ccccc3Sc3ccc(Cl)cc32)CCN1.
What is the InChIKey of 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one?
The InChIKey is PNIAPNIOQWLLFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2OS/c19-13-5-6-17-14(10-13)15(21-8-7-20-18(22)11-21)9-12-3-1-2-4-16(12)23-17/h1-6,10,15H,7-9,11H2,(H,20,22).
What are the key properties of 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one?
4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one has a molecular weight of 344.87 g/mol, XLogP of 3.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-2-one is sourced from PubChem (CID 50851956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).